OC1(CC(=O)OCC2=CC=CC=N2)CCCCC1

InChIKey=MBLIGXQGVIIHPK-UHFFFAOYSA-N

C14H19NO3

249.31

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Alcohols and polyols

Secondary alcohols

Cyclohexanols

Pyridines and derivatives Tertiary alcohols Heteroaromatic compounds Cyclic alcohols and derivatives Carboxylic acid esters Monocarboxylic acids and derivatives Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Cyclohexanol - Pyridine - Cyclic alcohol - Tertiary alcohol - Heteroaromatic compound - Carboxylic acid ester - Azacycle - Organoheterocyclic compound - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Carbonyl group - Organopnictogen compound - Organonitrogen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as cyclohexanols. These are compounds containing an alcohol group attached to a cyclohexane ring.

Not available