CC(C)CC(NC(C)=O)C1OC(CC1C(O)=O)C(O)=O

InChIKey=MBDVCBOMGHPTKR-UHFFFAOYSA-N

C13H21NO6

287.312

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Gamma amino acids and derivatives

Dicarboxylic acids and derivatives Oxolanes Acetamides Secondary carboxylic acid amides Oxacyclic compounds Dialkyl ethers Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic heteromonocyclic compounds

Gamma amino acid or derivatives - Dicarboxylic acid or derivatives - Oxolane - Acetamide - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid - Dialkyl ether - Ether - Oxacycle - Organoheterocyclic compound - Organic oxide - Organic nitrogen compound - Organic oxygen compound - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Carbonyl group - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as gamma amino acids and derivatives. These are amino acids having a (-NH2) group attached to the gamma carbon atom.

Not available