CCOC(=O)CC(=O)NP(=O)(OC)SC

InChIKey=LXHIGQCQMDOLFZ-UHFFFAOYSA-N

C7H14NO5PS

255.22

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid amides

N-acylphosphoramidothioic acid and derivatives

1,3-dicarbonyl compounds Carboxylic acid esters Sulfenyl compounds Organothiophosphorus compounds Monocarboxylic acids and derivatives Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aliphatic acyclic compounds

N-acylphosphoramidothioic acid or derivatives - 1,3-dicarbonyl compound - Carboxylic acid ester - Sulfenyl compound - Organothiophosphorus compound - Monocarboxylic acid or derivatives - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as n-acylphosphoramidothioic acid and derivatives. These are compounds containing phosphoramidothioic acid or a derivative thereof, which is N-acylated.

Not available