NC(=O)C(=O)C1=CN=C(F)C=C1

InChIKey=LVRXKHRNDUINEP-UHFFFAOYSA-N

C7H5FN2O2

168.127

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones

Aryl ketones

2-halopyridines Aryl fluorides Heteroaromatic compounds Primary carboxylic acid amides Azacyclic compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Aryl ketone - 2-halopyridine - Aryl fluoride - Aryl halide - Pyridine - Heteroaromatic compound - Primary carboxylic acid amide - Carboxamide group - Organoheterocyclic compound - Carboxylic acid derivative - Azacycle - Hydrocarbon derivative - Organonitrogen compound - Organofluoride - Organohalogen compound - Organic oxide - Organic nitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl ketones. These are organic aromatic compounds that contain a ketone group substituted at one C-atom with an aryl group. They have the generic structure RC(=O)R', where R = aryl group and R'=organyl group.

Not available