FC(F)(F)C(=O)N1[C@@H]2[C@H]1C1=CSC=C1C2=O

InChIKey=LSZZQAZNNKFHCJ-VLPQENBJSA-N

C9H4F3NO2S

247.19

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Thiophenes Tertiary carboxylic acid amides Heteroaromatic compounds Aziridines Azacyclic compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides

Aromatic heteropolycyclic compounds

Aryl alkyl ketone - Tertiary carboxylic acid amide - Thiophene - Heteroaromatic compound - Carboxamide group - Organoheterocyclic compound - Carboxylic acid derivative - Aziridine - Azacycle - Hydrocarbon derivative - Organic oxide - Organic nitrogen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Alkyl fluoride - Alkyl halide - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available