CN(C)C(=O)CC1(O)CCCC(C1)\C=C\C(O)CCCCC1=CC=CC=C1

InChIKey=LQQOFRLZJKZLCO-CCEZHUSRSA-N

C23H35NO3

373.537

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Alcohols and polyols

Secondary alcohols

Cyclohexanols

Benzene and substituted derivatives Tertiary carboxylic acid amides Tertiary alcohols Cyclic alcohols and derivatives Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Cyclohexanol - Benzenoid - Monocyclic benzene moiety - Tertiary carboxylic acid amide - Tertiary alcohol - Cyclic alcohol - Carboxamide group - Carboxylic acid derivative - Organic nitrogen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organonitrogen compound - Carbonyl group - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as cyclohexanols. These are compounds containing an alcohol group attached to a cyclohexane ring.

Not available