CCOC(=O)CC1=NCCN(C1)C(=O)CCl

InChIKey=LKYHTTXLVGDTGX-UHFFFAOYSA-N

C10H15ClN2O3

246.69

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid amides

Tertiary carboxylic acid amides

Chloroacetamides Ketimines Carboxylic acid esters Propargyl-type 1,3-dipolar organic compounds Monocarboxylic acids and derivatives Azacyclic compounds Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl chlorides

Aliphatic heteromonocyclic compounds

Chloroacetamide - Tertiary carboxylic acid amide - Carboxylic acid ester - Ketimine - Monocarboxylic acid or derivatives - Azacycle - Organoheterocyclic compound - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Alkyl chloride - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic oxide - Organic oxygen compound - Imine - Organic nitrogen compound - Carbonyl group - Alkyl halide - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as tertiary carboxylic acid amides. These are compounds containing an amide derivative of carboxylic acid, with the general structure RN(R1)C(R2)=O (R1-R2 any atom but H).

Not available