CC1=C(CC2=C(C)C(C)=C(N2)C([O-])=O)NC(C([O-])=O)=C1C

InChIKey=LKOCQNUXEBDQNU-UHFFFAOYSA-L

C15H16N2O4

288.304

Organic compounds

Organoheterocyclic compounds

Pyrroles

Pyrrole carboxylic acids and derivatives

Pyrrole carboxylic acids

Pyrrole 2-carboxylic acids

Substituted pyrroles Heteroaromatic compounds Carboxylic acid salts Carboxylic acids Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Organic anions

Aromatic heteromonocyclic compounds

Pyrrole-2-carboxylic acid - Substituted pyrrole - Heteroaromatic compound - Carboxylic acid salt - Azacycle - Carboxylic acid - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organic anion - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as pyrrole 2-carboxylic acids. These are pyrrole carboxylic acids where the carboxyl group is attached at position C2.

Not available