CCSC(=O)CNC(=O)C1=CC=CC=C1

InChIKey=LIKRQQBRGFMVOU-UHFFFAOYSA-N

C11H13NO2S

223.29

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides

Hippuric acids and derivatives

N-acyl-alpha amino acids and derivatives Benzoyl derivatives Thioesters Secondary carboxylic acid amides Carbothioic S-esters Sulfenyl compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Hippuric acid or derivatives - N-acyl-alpha amino acid or derivatives - Alpha-amino acid or derivatives - Benzoyl - Carboxamide group - Carbothioic s-ester - Thiocarboxylic acid ester - Secondary carboxylic acid amide - Carboxylic acid derivative - Sulfenyl compound - Thiocarboxylic acid or derivatives - Organonitrogen compound - Hydrocarbon derivative - Organic nitrogen compound - Organic oxide - Carbonyl group - Organooxygen compound - Organosulfur compound - Organic oxygen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as hippuric acids and derivatives. These are compounds containing a hippuric acid or a derivative, with a structure characterized the presence of a benzoyl group linked to the N-terminal of a glycine.

Not available