CCC(=O)N(C)CN(C)C(=O)OCC(=O)OCC(=O)C(C)=C

InChIKey=LFIAOCYLAGARBL-UHFFFAOYSA-N

C14H22N2O6

314.338

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Alpha-acyloxy carbonyl compounds

Alpha-acyloxy ketones

Alpha-branched alpha,beta-unsaturated ketones Tertiary carboxylic acid amides Enones Carbamate esters Acryloyl compounds Ketones Carboxylic acid esters Monocarboxylic acids and derivatives Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aliphatic acyclic compounds

Alpha-acyloxy ketone - Alpha-branched alpha,beta-unsaturated-ketone - Acryloyl-group - Enone - Tertiary carboxylic acid amide - Alpha,beta-unsaturated ketone - Carbamic acid ester - Carboxamide group - Carboxylic acid ester - Ketone - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Organic nitrogen compound - Organic oxide - Organonitrogen compound - Hydrocarbon derivative - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as alpha-acyloxy ketones. These are ketones that have an acyloxy substituent alpha to the carbonyl group. They have the general structure R4C(=O)OC(R2)(R3)C(R1)=O (R1=organyl, R4=H or organyl; R2,R3 = any atom).

Not available