CCNC(=O)NOCC(=O)N[C@@H](CCCCN(C(O)=O)C(C)(C)C)C(=O)N(CC1=CC=CC2=C1N=CC=C2)[C@@H](C)C(OCC)OCC

InChIKey=LDUHAQCMQPRFRJ-OZXSUGGESA-N

C33H52N6O8

660.813

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Not available

Peptides

N-acyl-alpha amino acids and derivatives Alpha amino acid amides Quinolines and derivatives Pyridines and derivatives Benzenoids N-acyl amines Tertiary carboxylic acid amides Heteroaromatic compounds Secondary carboxylic acid amides Carbamic acids Acetals Azacyclic compounds Organonitrogen compounds Carbonyl compounds Organopnictogen compounds Hydrocarbon derivatives Organic oxides

Aromatic heteropolycyclic compounds

Alpha peptide - N-acyl-alpha amino acid or derivatives - Alpha-amino acid amide - Alpha-amino acid or derivatives - Quinoline - N-acyl-amine - Benzenoid - Pyridine - Heteroaromatic compound - Tertiary carboxylic acid amide - Carbamic acid - Carbamic acid derivative - Carboxamide group - Secondary carboxylic acid amide - Acetal - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organonitrogen compound - Organooxygen compound - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as peptides. These are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another.

Not available