CCCCCCCC\C=C\CCCCCCCC(=O)NOP(O)(=O)OCCC

InChIKey=LDJQQLRNKYKIHR-VAWYXSNFSA-N

C21H42NO5P

419.543

Organic compounds

Organic acids and derivatives

Organic phosphoric acids and derivatives

Phosphate esters

Alkyl phosphates

Monoalkyl phosphates

Carboxylic acids and derivatives Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Monoalkyl phosphate - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as monoalkyl phosphates. These are organic compounds containing a phosphate group that is linked to exactly one alkyl chain.

Not available