CCN(CC)C(=O)CC(=O)C1=CN=CN1

InChIKey=LBLPCFRKJABSKZ-UHFFFAOYSA-N

C10H15N3O2

209.249

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Carbonylimidazoles 1,3-dicarbonyl compounds Tertiary carboxylic acid amides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Aryl alkyl ketone - Imidazole-4-carbonyl group - 1,3-dicarbonyl compound - Azole - Imidazole - Tertiary carboxylic acid amide - Heteroaromatic compound - Carboxamide group - Carboxylic acid derivative - Organoheterocyclic compound - Azacycle - Organic oxide - Organic nitrogen compound - Organonitrogen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available