CCN\C(SC)=C\C(=O)C1=CC(=CS1)C(C)C

InChIKey=KXUARJAMCKYPJL-QPEQYQDCSA-N

C13H19NOS2

269.42

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones

Aryl ketones

Vinylogous thioesters Vinylogous amides Thiophenes Heteroaromatic compounds Enones Acryloyl compounds Ketene acetals Sulfenyl compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Aryl ketone - Vinylogous thioester - Heteroaromatic compound - Acryloyl-group - Vinylogous amide - Alpha,beta-unsaturated ketone - Thiophene - Enone - Ketene acetal or derivatives - Organoheterocyclic compound - Sulfenyl compound - Hydrocarbon derivative - Organic nitrogen compound - Organosulfur compound - Organonitrogen compound - Organic oxide - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl ketones. These are organic aromatic compounds that contain a ketone group substituted at one C-atom with an aryl group. They have the generic structure RC(=O)R', where R = aryl group and R'=organyl group.

Not available