C[C@H](SC(=O)C1=CC=CS1)C(O)=O

InChIKey=KXHUVWDIKYRVPQ-YFKPBYRVSA-N

C8H8O3S2

216.27

Organic compounds

Organoheterocyclic compounds

Thiophenes

Thiophene carboxylic acids and derivatives

Not available

Thiophene carboxylic acids and derivatives

Heteroaromatic compounds Thioesters Carbothioic S-esters Sulfenyl compounds Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Thiophene carboxylic acid or derivatives - Heteroaromatic compound - Thiocarboxylic acid ester - Carbothioic s-ester - Sulfenyl compound - Thiocarboxylic acid or derivatives - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Carbonyl group - Organic oxygen compound - Organosulfur compound - Organooxygen compound - Organic oxide - Hydrocarbon derivative - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as thiophene carboxylic acids and derivatives. These are compounds containing a thiophene ring which bears a carboxylic acid group (or a salt/ester thereof).

Not available