CSC[C@H]1C[C@]1(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C

InChIKey=KXFACRNSHKPHFH-MEBBXXQBSA-N

C15H27NO4S

317.44

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Cyclopropanecarboxylic acids and derivatives Carbamate esters Carboxylic acid esters Sulfenyl compounds Monocarboxylic acids and derivatives Dialkylthioethers Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic homomonocyclic compounds

Alpha-amino acid or derivatives - Cyclopropanecarboxylic acid or derivatives - Carbamic acid ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Thioether - Sulfenyl compound - Dialkylthioether - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organic oxide - Organic nitrogen compound - Hydrocarbon derivative - Carbonyl group - Organic oxygen compound - Aliphatic homomonocyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available