CCOP(=O)(CNP(=O)(OCC)OCC)OCC

InChIKey=KWKOFUVGUYSLFN-UHFFFAOYSA-N

C9H23NO6P2

303.232

Organic compounds

Organic acids and derivatives

Organic phosphoric acids and derivatives

Phosphate esters

Not available

Phosphoric diester monoamides

Dialkyl alkylphosphonates Phosphonic acid esters Organic phosphoramides Organophosphorus compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aliphatic acyclic compounds

Phosphoric diester monoamide - Dialkyl alkylphosphonate - Phosphonic acid diester - Organic phosphoric acid amide - Phosphonic acid ester - Organophosphonic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organophosphorus compound - Organooxygen compound - Organonitrogen compound - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as phosphoric diester monoamides. These are organophosphorus compounds containing a monoamide derivative of a phosphoric acid diester functional group. They have the general structure R1OP(=O)(OR2)N(R3)R4, where R1-R2 = organyl group and R3-R4 = H or organyl.

Not available