COC(=O)C1=C(SC(=O)N(C)C)C=CC(=C1)N1C2=C(CCCC2)C=C1C1=CC=CC=C1

InChIKey=KTPCMFORWQTGEA-UHFFFAOYSA-N

C25H26N2O3S

434.55

Organic compounds

Organoheterocyclic compounds

Pyrroles

Substituted pyrroles

Phenylpyrroles

Diphenylpyrroles

O-sulfanylbenzoic acids and derivatives Benzoic acid esters Indoles and derivatives Benzoyl derivatives Aryl thioethers Methyl esters Heteroaromatic compounds Thiocarbamic acid derivatives Sulfenyl compounds Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteropolycyclic compounds

1,2-diphenylpyrrole - Benzoate ester - O-sulfanylbenzoic acid or derivatives - Benzoic acid or derivatives - Indole or derivatives - Aryl thioether - Benzoyl - Monocyclic benzene moiety - Benzenoid - Heteroaromatic compound - Methyl ester - Carboxylic acid ester - Thiocarbamic acid derivative - Carboxylic acid derivative - Azacycle - Sulfenyl compound - Organic oxygen compound - Organic nitrogen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as diphenylpyrroles. These are aromatic heterocyclic compounds with a structure based on a pyrrole ring linked to exactly two phenyl groups.

Not available