CC1=CC=C(S1)C1=CC=C(S1)C1=C(C)C(C(O)=O)=C(C2=CC=C(S2)C2=CC=C(C)S2)C(C)=C1C(O)=O

InChIKey=KSZCNEFVCLRSKX-UHFFFAOYSA-N

C28H22O4S4

550.72

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Phthalic acid and derivatives

P-phthalic acid and derivatives

Bi- and oligothiophenes Benzoic acids p-Xylenes Benzoyl derivatives 2,5-disubstituted thiophenes Heteroaromatic compounds Carboxylic acids Organooxygen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Para_phthalic_acid - Bithiophene - Benzoic acid - Benzoyl - P-xylene - Xylene - 2,5-disubstituted thiophene - Heteroaromatic compound - Thiophene - Carboxylic acid derivative - Carboxylic acid - Organoheterocyclic compound - Hydrocarbon derivative - Organic oxygen compound - Organooxygen compound - Organic oxide - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as p-phthalic acid and derivatives. These are compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 4.

Not available