CC(NC(C)(C)C)C(=O)C1=CC=CO1

InChIKey=KQERXGPGIZOUKH-UHFFFAOYSA-N

C11H17NO2

195.262

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Heteroaromatic compounds Furans Alpha-amino ketones Oxacyclic compounds Dialkylamines Organopnictogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Aryl alkyl ketone - Heteroaromatic compound - Furan - Alpha-aminoketone - Oxacycle - Organoheterocyclic compound - Secondary amine - Secondary aliphatic amine - Organic nitrogen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organonitrogen compound - Amine - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available