CCOC(=O)CC[C@H](NC(=O)OC)C=C

InChIKey=KPKUVVDIZJKERG-MRVPVSSYSA-N

C10H17NO4

215.249

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Gamma amino acids and derivatives

Fatty acid esters Methylcarbamates Carboxylic acid esters Monocarboxylic acids and derivatives Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Gamma amino acid or derivatives - Fatty acid ester - Fatty acyl - Methylcarbamate - Carbamic acid ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as gamma amino acids and derivatives. These are amino acids having a (-NH2) group attached to the gamma carbon atom.

Not available