[O-]C(=O)C1=CC=C(C=C1)C([O-])=O

InChIKey=KKEYFWRCBNTPAC-UHFFFAOYSA-L

C8H4O4

164.117

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Phthalic acid and derivatives

P-phthalic acid and derivatives

Benzoic acids Benzoyl derivatives Dicarboxylic acids and derivatives Carboxylic acids Organooxygen compounds Organic oxides Hydrocarbon derivatives Organic anions

Aromatic homomonocyclic compounds

Para_phthalic_acid - Benzoic acid - Benzoyl - Dicarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organic anion - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as p-phthalic acid and derivatives. These are compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 4.

CHEBI:30043 : phthalate
META CYC (TEREPHTHALATE) : a small molecule