CC(=O)O[C@@H]1C[C@H]2C(CCCC2(C)C)C(=O)[C@H](C[C@@H]2C=C1C(=O)C2=C)OC(C)=O

InChIKey=KEQXOUOSUPOFJG-MWDBYQCVSA-N

C23H30O6

402.487

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Alpha-acyloxy carbonyl compounds

Alpha-acyloxy ketones

Dicarboxylic acids and derivatives Ketones Carboxylic acid esters Organic oxides Hydrocarbon derivatives

Aliphatic homopolycyclic compounds

Alpha-acyloxy ketone - Dicarboxylic acid or derivatives - Ketone - Carboxylic acid ester - Carboxylic acid derivative - Organic oxide - Hydrocarbon derivative - Aliphatic homopolycyclic compound

This compound belongs to the class of organic compounds known as alpha-acyloxy ketones. These are ketones that have an acyloxy substituent alpha to the carbonyl group. They have the general structure R4C(=O)OC(R2)(R3)C(R1)=O (R1=organyl, R4=H or organyl; R2,R3 = any atom).

Not available