CCOC(=O)C1=C(C)C(C(=O)OCC)=C(NC(=O)CSS(O)(=O)=O)S1

InChIKey=JSEPBNSTVBFHSQ-UHFFFAOYSA-N

C13H17NO8S3

411.46

Organic compounds

Organoheterocyclic compounds

Thiophenes

Thiophene carboxylic acids and derivatives

Not available

Thiophene carboxylic acids and derivatives

N-arylamides S-alkyl thiosulfates Vinylogous amides Heteroaromatic compounds Secondary carboxylic acid amides Carboxylic acid esters Sulfenyl compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Thiophene carboxylic acid or derivatives - N-arylamide - S-alkyl thiosulfate - Vinylogous amide - Heteroaromatic compound - Secondary carboxylic acid amide - Carboxylic acid ester - Carboxamide group - Sulfenyl compound - Carboxylic acid derivative - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Carbonyl group - Hydrocarbon derivative - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as thiophene carboxylic acids and derivatives. These are compounds containing a thiophene ring which bears a carboxylic acid group (or a salt/ester thereof).

Not available