O=C1CN(\N=C\C2=CC=CO2)C(=S)N1

InChIKey=JHEPFRZAJCEWOZ-RUDMXATFSA-N

C8H7N3O2S

209.22

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Thiosemicarbazones Imidazolidinones Heteroaromatic compounds Furans Oxacyclic compounds Azacyclic compounds Organosulfur compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Alpha-amino acid or derivatives - Imidazolidinone - Thiosemicarbazone - Furan - Imidazolidine - Heteroaromatic compound - Oxacycle - Azacycle - Organoheterocyclic compound - Organopnictogen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available