CC(OC(C)=O)C1=CC2=C(S1)C(=O)C1=C(C(=CS1)C(C)OC(C)=O)C2=O

InChIKey=JFEMGTTXNHRUOR-UHFFFAOYSA-N

C18H16O6S2

392.44

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones

Aryl ketones

2,3,5-trisubstituted thiophenes Dicarboxylic acids and derivatives Heteroaromatic compounds Carboxylic acid esters Organic oxides Hydrocarbon derivatives

Aromatic heteropolycyclic compounds

Aryl ketone - 2,3,5-trisubstituted thiophene - Dicarboxylic acid or derivatives - Heteroaromatic compound - Thiophene - Carboxylic acid ester - Organoheterocyclic compound - Carboxylic acid derivative - Organic oxide - Hydrocarbon derivative - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as aryl ketones. These are organic aromatic compounds that contain a ketone group substituted at one C-atom with an aryl group. They have the generic structure RC(=O)R', where R = aryl group and R'=organyl group.

Not available