OP(=O)(NCC=C)OC(C1CCCCC1)=C(Cl)Cl

InChIKey=JDLRVWPLYBAMBQ-UHFFFAOYSA-N

C11H18Cl2NO3P

314.14

Organic compounds

Organic acids and derivatives

Organic phosphoric acids and derivatives

Organic phosphoramides

Organic phosphoric acid monoamides

Phosphoric monoester monoamides

Phosphate esters Vinyl chlorides Chloroalkenes Organooxygen compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives

Aliphatic homomonocyclic compounds

Phosphoric monoester monoamide - Phosphoric acid ester - Chloroalkene - Haloalkene - Vinyl halide - Vinyl chloride - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Aliphatic homomonocyclic compound

This compound belongs to the class of organic compounds known as phosphoric monoester monoamides. These are organophosphorus compounds containing a monoamide derivative of a phosphoric acid monoester functional group. They have the general structure R1OP(=O)(OH)N(R3)R4, where R1 = organyl group and R3-R4 = H or organyl.

Not available