CCCCN(CCCC)C(=O)CC1C(O)CCC2C(C)(CO)C(O)CCC12C

InChIKey=JBZRBJLHXOKMBR-UHFFFAOYSA-N

C23H43NO4

397.6

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid amides

Tertiary carboxylic acid amides

Secondary alcohols Cyclic alcohols and derivatives Primary alcohols Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic homopolycyclic compounds

Tertiary carboxylic acid amide - Cyclic alcohol - Secondary alcohol - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Organonitrogen compound - Carbonyl group - Alcohol - Aliphatic homopolycyclic compound

This compound belongs to the class of organic compounds known as tertiary carboxylic acid amides. These are compounds containing an amide derivative of carboxylic acid, with the general structure RN(R1)C(R2)=O (R1-R2 any atom but H).

Not available