CCOP(=S)(OCC)OC1=NC(=NC(C)=C1Cl)C(Cl)(Cl)Cl

InChIKey=IZGFTWZXGALYJS-UHFFFAOYSA-N

C10H13Cl4N2O3PS

414.06

Organic compounds

Organic acids and derivatives

Organic thiophosphoric acids and derivatives

Thiophosphoric acid esters

Aryl thiophosphates

Pyrimidinyl phosphorothioates

Thiophosphate triesters Halopyrimidines Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives Alkyl chlorides

Aromatic heteromonocyclic compounds

Pyrimidinyl phosphorothioate - Thiophosphate triester - Halopyrimidine - Aryl chloride - Aryl halide - Pyrimidine - Heteroaromatic compound - Azacycle - Organoheterocyclic compound - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Hydrocarbon derivative - Organic oxygen compound - Organic nitrogen compound - Alkyl chloride - Alkyl halide - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as pyrimidinyl phosphorothioates. These are organic compounds containing the thiophosphoric acid functional group or a derivative thereof, with the general structure ROP(OR')(OR'')=S, where R= pyrimidine, R' = organyl group , and R\" = any atom.

Not available