CC(NC(=O)C(C)SC(=O)C1=CC=CS1)C(O)=O

InChIKey=IEROUWYIIZJDIA-UHFFFAOYSA-N

C11H13NO4S2

287.35

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives - Alpha amino acids and derivatives - N-acyl-alpha amino acids and derivatives

N-acyl-alpha amino acids

Alanine and derivatives Thiophene carboxylic acids and derivatives Heteroaromatic compounds Thioesters Secondary carboxylic acid amides Carbothioic S-esters Sulfenyl compounds Monocarboxylic acids and derivatives Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

N-acyl-alpha-amino acid - Alanine or derivatives - Thiophene carboxylic acid or derivatives - Thiophene - Heteroaromatic compound - Carboxamide group - Secondary carboxylic acid amide - Thiocarboxylic acid ester - Carbothioic s-ester - Thiocarboxylic acid or derivatives - Monocarboxylic acid or derivatives - Sulfenyl compound - Carboxylic acid - Organoheterocyclic compound - Organic oxide - Organic oxygen compound - Carbonyl group - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as n-acyl-alpha amino acids. These are compounds containing an alpha amino acid which bears an acyl group at its terminal nitrogen atom.

Not available