CCOP(=O)(OCC)SCCSCC(=O)OC

InChIKey=IDICGNDWKVFNQX-UHFFFAOYSA-N

C9H19O5PS2

302.34

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid esters

Methyl esters

Sulfenyl compounds Organothiophosphorus compounds Monocarboxylic acids and derivatives Dialkylthioethers Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Methyl ester - Dialkylthioether - Sulfenyl compound - Thioether - Organothiophosphorus compound - Monocarboxylic acid or derivatives - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as methyl esters. These are organic compounds containing a carboxyl group that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=H or organyl group and R'=methyl group.

Not available