COC(=O)[C@H](CS)NC(=O)C(=O)N[C@@H](CS)C(=O)OC

InChIKey=ICFXLCXJIIRKPI-WDSKDSINSA-N

C10H16N2O6S2

324.37

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Not available

Peptides

N-acyl-alpha amino acids and derivatives Alpha amino acid esters Cysteine and derivatives Alpha amino acid amides Dicarboxylic acids and derivatives Methyl esters Secondary carboxylic acid amides Alkylthiols Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Alpha peptide - Alpha-amino acid ester - N-acyl-alpha amino acid or derivatives - Alpha-amino acid amide - Cysteine or derivatives - Alpha-amino acid or derivatives - Dicarboxylic acid or derivatives - Methyl ester - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid ester - Alkylthiol - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Organosulfur compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as peptides. These are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another.

Not available