OC(=O)CNC(=O)C1=CC=C(NC(=O)C2=CC=CC=C2)C=C1

InChIKey=HPKMDTLAURFRHS-UHFFFAOYSA-N

C16H14N2O4

298.298

Organic compounds

Benzenoids

Benzene and substituted derivatives

Anilides

Aromatic anilides

Benzanilides

N-acyl-alpha amino acids Hippuric acids Benzoyl derivatives Secondary carboxylic acid amides Monocarboxylic acids and derivatives Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Benzanilide - Hippuric acid or derivatives - N-acyl-alpha amino acid or derivatives - N-acyl-alpha-amino acid - Hippuric acid - Alpha-amino acid or derivatives - Benzamide - Benzoic acid or derivatives - Benzoyl - Secondary carboxylic acid amide - Carboxamide group - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Organic nitrogen compound - Organooxygen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organonitrogen compound - Organic oxygen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as benzanilides. These are aromatic compounds containing an anilide group in which the carboxamide group is substituted with a benzene ring. They have the general structure RNC(=O)R', where R,R'= benzene.

Not available