CCCOP(=S)(OCCC)SCC(=O)OC(N1C=NC=N1)C(=O)C(C)(C)C

InChIKey=HMPVDZFAUYNIPR-UHFFFAOYSA-N

C16H28N3O5PS2

437.51

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Alpha-acyloxy carbonyl compounds

Alpha-acyloxy ketones

Dithiophosphate S-esters Dithiophosphate O-esters Triazoles Heteroaromatic compounds Ketones Carboxylic acid esters Sulfenyl compounds Organothiophosphorus compounds Monocarboxylic acids and derivatives Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Alpha-acyloxy ketone - Dithiophosphate o-ester - Dithiophosphate s-ester - Azole - Heteroaromatic compound - 1,2,4-triazole - Organic dithiophosphate - Carboxylic acid ester - Ketone - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Organothiophosphorus compound - Azacycle - Sulfenyl compound - Organoheterocyclic compound - Organonitrogen compound - Organosulfur compound - Organic oxide - Hydrocarbon derivative - Organic nitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as alpha-acyloxy ketones. These are ketones that have an acyloxy substituent alpha to the carbonyl group. They have the general structure R4C(=O)OC(R2)(R3)C(R1)=O (R1=organyl, R4=H or organyl; R2,R3 = any atom).

Not available