CCOC(=O)C1CCCC(C1)NC(=O)NCCCl

InChIKey=HMPBTUVIRDEDHP-UHFFFAOYSA-N

C12H21ClN2O3

276.76

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Gamma amino acids and derivatives

Ureas Carboxylic acid esters Monocarboxylic acids and derivatives Organopnictogen compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl chlorides

Aliphatic homomonocyclic compounds

Gamma amino acid or derivatives - Urea - Carbonic acid derivative - Carboxylic acid ester - Monocarboxylic acid or derivatives - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Carbonyl group - Alkyl halide - Alkyl chloride - Aliphatic homomonocyclic compound

This compound belongs to the class of organic compounds known as gamma amino acids and derivatives. These are amino acids having a (-NH2) group attached to the gamma carbon atom.

Not available