FC(F)(Cl)C(F)(F)C(=O)OC=C

InChIKey=HLZZKBZAPCCVIE-UHFFFAOYSA-N

C5H3ClF4O2

206.52

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid esters

Enol esters

Alpha-halocarboxylic acid derivatives Monocarboxylic acids and derivatives Organofluorides Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl fluorides Alkyl chlorides

Aliphatic acyclic compounds

Alpha-halocarboxylic acid derivative - Alpha-halocarboxylic acid or derivatives - Enol ester - Monocarboxylic acid or derivatives - Organofluoride - Organochloride - Organohalogen compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Organic oxygen compound - Alkyl halide - Alkyl fluoride - Alkyl chloride - Organooxygen compound - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as enol esters. These are ester derivatives of enols. They have the general formula RC=COC(=O)R' where R, R' = H or organyl group.

Not available