CCC1(COC(NC(=O)C(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F)COC1

InChIKey=HFWKDEHNGHVSCP-UHFFFAOYSA-N

C13H13F12NO3

459.232

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid amides

Secondary carboxylic acid amides

Oxetanes Oxacyclic compounds Dialkyl ethers Organopnictogen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl fluorides

Aliphatic heteromonocyclic compounds

Oxetane - Secondary carboxylic acid amide - Dialkyl ether - Ether - Organoheterocyclic compound - Oxacycle - Alkyl halide - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Alkyl fluoride - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as secondary carboxylic acid amides. These are compounds containing a secondary carboxylic acid amide functional group, with the general structure RC(=O)N(R')H (R,R'=alkyl, aryl).

Not available