O=P1(OCC2(CO1)COP(=O)(OC2)N1CCCCC1)N1CCCCC1

InChIKey=HDYBUFLQGBXAFG-UHFFFAOYSA-N

C15H28N2O6P2

394.345

Organic compounds

Organic acids and derivatives

Organic phosphoric acids and derivatives

Phosphate esters

Not available

Phosphoric diester monoamides

Piperidines Organic phosphoramides Oxacyclic compounds Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aliphatic heteropolycyclic compounds

Phosphoric diester monoamide - Organic phosphoric acid amide - Piperidine - Oxacycle - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aliphatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as phosphoric diester monoamides. These are organophosphorus compounds containing a monoamide derivative of a phosphoric acid diester functional group. They have the general structure R1OP(=O)(OR2)N(R3)R4, where R1-R2 = organyl group and R3-R4 = H or organyl.

Not available