CCOC(=O)CC(=O)C1=C(C)NC(C(=O)OCC)=C1C

InChIKey=GXVFFIRVKMUHNF-UHFFFAOYSA-N

C14H19NO5

281.308

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Pyrrole carboxylic acids and derivatives Fatty acid esters Beta-keto acids and derivatives Substituted pyrroles Dicarboxylic acids and derivatives 1,3-dicarbonyl compounds Vinylogous amides Heteroaromatic compounds Carboxylic acid esters Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Pyrrole-2-carboxylic acid or derivatives - Aryl alkyl ketone - Beta-keto acid - Fatty acid ester - Dicarboxylic acid or derivatives - Keto acid - Substituted pyrrole - 1,3-dicarbonyl compound - Fatty acyl - Pyrrole - Vinylogous amide - Heteroaromatic compound - Carboxylic acid ester - Carboxylic acid derivative - Organoheterocyclic compound - Azacycle - Hydrocarbon derivative - Organic oxide - Organonitrogen compound - Organic nitrogen compound - Organopnictogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available