OCCCCO[C@@H]1C[C@@H](C=C(O1)C(=O)N1CC1)C1CCCCC1

InChIKey=GXBZEXCAUSLKLV-WBVHZDCISA-N

C18H29NO4

323.433

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid amides

Tertiary carboxylic acid amides

Oxacyclic compounds Aziridines Azacyclic compounds Acetals Primary alcohols Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic heteromonocyclic compounds

Tertiary carboxylic acid amide - Acetal - Aziridine - Organoheterocyclic compound - Azacycle - Oxacycle - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Primary alcohol - Organooxygen compound - Organonitrogen compound - Carbonyl group - Organic oxygen compound - Alcohol - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as tertiary carboxylic acid amides. These are compounds containing an amide derivative of carboxylic acid, with the general structure RN(R1)C(R2)=O (R1-R2 any atom but H).

Not available