CC(C)N(CC(=O)N(CC1=CC=CS1)CC1=CC2=C(OCO2)C=C1)C(=O)C(C)Cl

InChIKey=GVHSSNUZQZQVPW-UHFFFAOYSA-N

C21H25ClN2O4S

436.95

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Benzodioxoles Benzenoids Thiophenes Tertiary carboxylic acid amides Heteroaromatic compounds Oxacyclic compounds Acetals Organopnictogen compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl chlorides

Aromatic heteropolycyclic compounds

Alpha-amino acid or derivatives - Benzodioxole - Benzenoid - Tertiary carboxylic acid amide - Thiophene - Heteroaromatic compound - Carboxamide group - Acetal - Oxacycle - Organoheterocyclic compound - Organic oxide - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organopnictogen compound - Carbonyl group - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Alkyl chloride - Alkyl halide - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available