CNP1(=O)OC(=CCN1CCCl)C1=CC=CC=C1

InChIKey=GLVCYNSLPDEUSJ-UHFFFAOYSA-N

C12H16ClN2O2P

286.7

Organic compounds

Organic acids and derivatives

Organic phosphoric acids and derivatives

Organic phosphoramides

Organic phosphoric acid diamides

Phosphoric monoester diamides

Benzene and substituted derivatives Oxacyclic compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives Alkyl chlorides

Aromatic heteromonocyclic compounds

Phosphoric monoester diamide - Monocyclic benzene moiety - Benzenoid - Organoheterocyclic compound - Azacycle - Oxacycle - Alkyl chloride - Organic oxide - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic nitrogen compound - Alkyl halide - Hydrocarbon derivative - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as phosphoric monoester diamides. These are organophosphorus compounds containing a monoamide derivative of a phosphoric acid diester functional group. They have the general structure R1OP(=O)(N(R2)R3)N(R4)R5, where R1 = organyl group and R2-R5 = H or organyl.

Not available