CCCCCCN(C(=O)CCCBr)P(=O)(OCC#C)SC

InChIKey=GINSZRYOPMPKMP-UHFFFAOYSA-N

C14H25BrNO3PS

398.3

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid amides

N-acylphosphoramidothioic acid and derivatives

Sulfenyl compounds Organothiophosphorus compounds Acetylides Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl bromides

Aliphatic acyclic compounds

N-acylphosphoramidothioic acid or derivatives - Organothiophosphorus compound - Sulfenyl compound - Acetylide - Alkyl bromide - Organic oxide - Hydrocarbon derivative - Organic oxygen compound - Organic nitrogen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Carbonyl group - Alkyl halide - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as n-acylphosphoramidothioic acid and derivatives. These are compounds containing phosphoramidothioic acid or a derivative thereof, which is N-acylated.

Not available