CN(C)P(=O)(OC1=C(C=CO1)C(C)(C)O)N(C)C

InChIKey=GILRFLFAOZXIJP-UHFFFAOYSA-N

C11H21N2O4P

276.273

Organic compounds

Organic acids and derivatives

Organic phosphoric acids and derivatives

Organic phosphoramides

Organic phosphoric acid diamides

Phosphoric monoester diamides

Phosphate esters Tertiary alcohols Heteroaromatic compounds Furans Oxacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Aromatic alcohols

Aromatic heteromonocyclic compounds

Phosphoric monoester diamide - Phosphoric acid ester - Furan - Tertiary alcohol - Heteroaromatic compound - Organoheterocyclic compound - Oxacycle - Alcohol - Hydrocarbon derivative - Organic oxide - Aromatic alcohol - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as phosphoric monoester diamides. These are organophosphorus compounds containing a monoamide derivative of a phosphoric acid diester functional group. They have the general structure R1OP(=O)(N(R2)R3)N(R4)R5, where R1 = organyl group and R2-R5 = H or organyl.

Not available