O=P1(OC(=CCN1C1=CC=CC=C1)C1=CC=CC=C1)N1CCOCC1

InChIKey=GCDFPGGZUBAPTM-UHFFFAOYSA-N

C19H21N2O3P

356.362

Organic compounds

Organic acids and derivatives

Organic phosphoric acids and derivatives

Organic phosphoramides

Organic phosphoric acid diamides

Phosphoric monoester diamides

Morpholines Benzene and substituted derivatives Oxacyclic compounds Dialkyl ethers Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Phosphoric monoester diamide - Monocyclic benzene moiety - Morpholine - Oxazinane - Benzenoid - Azacycle - Organoheterocyclic compound - Ether - Dialkyl ether - Oxacycle - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as phosphoric monoester diamides. These are organophosphorus compounds containing a monoamide derivative of a phosphoric acid diester functional group. They have the general structure R1OP(=O)(N(R2)R3)N(R4)R5, where R1 = organyl group and R2-R5 = H or organyl.

Not available