OC(=O)C1=CC2=C(C(=O)OC2=S)C(=C1)C1=CC=CC=C1

InChIKey=GBQBAFZUTXWINQ-UHFFFAOYSA-N

C15H8O4S

284.29

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Phthalic acid and derivatives

P-phthalic acid and derivatives

Thiophthalic anhydrides Isobenzofuranones Benzofuranones Thiocarboxylic acids and derivatives Oxacyclic compounds Carboxylic acids Thiocarbonyl compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteropolycyclic compounds

Para_phthalic_acid - Thiophthalic anhydride - Benzofuranone - Isobenzofuranone - Isocoumaran - Carboxylic acid derivative - Carboxylic acid - Oxacycle - Organoheterocyclic compound - Thiocarboxylic acid or derivatives - Organic oxygen compound - Thiocarbonyl group - Organosulfur compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as p-phthalic acid and derivatives. These are compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 4.

Not available