CCCS(=O)(=O)CCC(=O)C1=CC=CS1

InChIKey=GAYFAIOANANBBR-UHFFFAOYSA-N

C10H14O3S2

246.34

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Thiophenes Sulfones Heteroaromatic compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Aryl alkyl ketone - Heteroaromatic compound - Thiophene - Sulfonyl - Sulfone - Organoheterocyclic compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available