COP(=S)(OC)OC1=NC(=NC(C)=C1)C(Cl)(Cl)Cl

InChIKey=FWEIMAPCNKQJKJ-UHFFFAOYSA-N

C8H10Cl3N2O3PS

351.56

Organic compounds

Organic acids and derivatives

Organic thiophosphoric acids and derivatives

Thiophosphoric acid esters

Aryl thiophosphates

Pyrimidinyl phosphorothioates

Thiophosphate triesters Pyrimidines and pyrimidine derivatives Heteroaromatic compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives Alkyl chlorides

Aromatic heteromonocyclic compounds

Pyrimidinyl phosphorothioate - Thiophosphate triester - Pyrimidine - Heteroaromatic compound - Organoheterocyclic compound - Azacycle - Alkyl chloride - Hydrocarbon derivative - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Alkyl halide - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as pyrimidinyl phosphorothioates. These are organic compounds containing the thiophosphoric acid functional group or a derivative thereof, with the general structure ROP(OR')(OR'')=S, where R= pyrimidine, R' = organyl group , and R\" = any atom.

Not available