C\C(\C=C\C(=O)NCCCC(=O)NO)=C/C1=CC=CC=C1

InChIKey=FUYOFGPPVLTBJP-OKLKQMLOSA-N

C16H20N2O3

288.347

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Gamma amino acids and derivatives

N-acyl amines Benzene and substituted derivatives Secondary carboxylic acid amides Hydroxamic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Gamma amino acid or derivatives - Benzenoid - N-acyl-amine - Monocyclic benzene moiety - Secondary carboxylic acid amide - Hydroxamic acid - Carboxamide group - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as gamma amino acids and derivatives. These are amino acids having a (-NH2) group attached to the gamma carbon atom.

Not available