OC(=O)C1=CC(=CC(CS)=C1)C(O)=O

InChIKey=FSRPFCXLFSQONO-UHFFFAOYSA-N

C9H8O4S

212.22

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Phthalic acid and derivatives

M-phthalic acid and derivatives

Benzoic acids Benzoyl derivatives Carboxylic acids Alkylthiols Organooxygen compounds Organic oxides Hydrocarbon derivatives

Aromatic homomonocyclic compounds

Meta_phthalic_acid - Benzoic acid - Benzoyl - Carboxylic acid - Carboxylic acid derivative - Alkylthiol - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as m-phthalic acid and derivatives. These are aromatic compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 2.

Not available